(S)-2-chloropropionic acid

(S)-2-chloropropionic acid
Cat.No.NP18061
CAS29617-66-1
MolFormula C3H5ClO2
MolWeight 108.52

Product Detail

Chemical Name(S)-2-chloropropionic acid
CAS29617-66-1
Purity >98%
MolFormula C3H5ClO2
MolWeight 108.52

Enquiry

Change